C10H18O10 — CID 88767921
2-[(2R,3R,4R,5S,6R)-2,3,4,5,6,7-hexahydroxyheptanoyl]oxypropanoic acid (PubChem CID 88767921) has the molecular formula C10H18O10 and a molecular weight of 298.24 g/mol. Its IUPAC name is 2-[(2R,3R,4R,5S,6R)-2,3,4,5,6,7-hexahydroxyheptanoyl]oxypropanoic acid.
| Compound Name | 2-[(2R,3R,4R,5S,6R)-2,3,4,5,6,7-hexahydroxyheptanoyl]oxypropanoic acid |
|---|---|
| PubChem CID | 88767921 |
| Molecular Formula | C10H18O10 |
| Molecular Weight | 298.24 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | 2-[(2R,3R,4R,5S,6R)-2,3,4,5,6,7-hexahydroxyheptanoyl]oxypropanoic acid |
| SMILES | CC(OC(=O)[C@H](O)[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO)C(=O)O |
| InChI | InChI=1S/C10H18O10/c1-3(9(17)18)20-10(19)8(16)7(15)6(14)5(13)4(12)2-11/h3-8,11-16H,2H2,1H3,(H,17,18)/t3?,4-,5+,6-,7-,8-/m1/s1 |
| InChIKey | PWBXZRFUDVEMSM-FNJAZQCLSA-N |
| XLogP | -4.20 |
| TPSA | 184.98 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.24 |
| LogP ≤ 5 | -4.20 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |