C7H14O7 — CID 122443560
methyl (2S,3R,4R)-2,3,4,5,6-pentahydroxyhexanoate (PubChem CID 122443560) has the molecular formula C7H14O7 and a molecular weight of 210.18 g/mol. Its IUPAC name is methyl (2S,3R,4R)-2,3,4,5,6-pentahydroxyhexanoate.
| Compound Name | methyl (2S,3R,4R)-2,3,4,5,6-pentahydroxyhexanoate |
|---|---|
| PubChem CID | 122443560 |
| Molecular Formula | C7H14O7 |
| Molecular Weight | 210.18 g/mol |
| Exact Mass | 210.07 |
| IUPAC Name | methyl (2S,3R,4R)-2,3,4,5,6-pentahydroxyhexanoate |
| SMILES | COC(=O)[C@@H](O)[C@H](O)[C@H](O)C(O)CO |
| InChI | InChI=1S/C7H14O7/c1-14-7(13)6(12)5(11)4(10)3(9)2-8/h3-6,8-12H,2H2,1H3/t3?,4-,5-,6+/m1/s1 |
| InChIKey | XKJLTJCYZRLXMM-SJLAOBFJSA-N |
| XLogP | -3.40 |
| TPSA | 127.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.18 |
| LogP ≤ 5 | -3.40 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |