C11H16O10 — CID 175130372
1-O-methyl 4-O-[(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoyl] (E)-but-2-enedioate (PubChem CID 175130372) has the molecular formula C11H16O10 and a molecular weight of 308.24 g/mol. Its IUPAC name is 1-O-methyl 4-O-[(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoyl] (E)-but-2-enedioate.
| Compound Name | 1-O-methyl 4-O-[(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoyl] (E)-but-2-enedioate |
|---|---|
| PubChem CID | 175130372 |
| Molecular Formula | C11H16O10 |
| Molecular Weight | 308.24 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | 1-O-methyl 4-O-[(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoyl] (E)-but-2-enedioate |
| SMILES | COC(=O)/C=C/C(=O)OC(=O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C11H16O10/c1-20-6(14)2-3-7(15)21-11(19)10(18)9(17)8(16)5(13)4-12/h2-3,5,8-10,12-13,16-18H,4H2,1H3/b3-2+/t5-,8-,9+,10-/m1/s1 |
| InChIKey | ZUBLPQZAXBOPHF-HQNVPPHXSA-N |
| XLogP | -3.78 |
| TPSA | 170.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.24 |
| LogP ≤ 5 | -3.78 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|