C9H16O7 — CID 10977424
methyl (E,4S,5R,6S,7R)-4,5,6,7,8-pentahydroxyoct-2-enoate (PubChem CID 10977424) has the molecular formula C9H16O7 and a molecular weight of 236.22 g/mol. Its IUPAC name is methyl (E,4S,5R,6S,7R)-4,5,6,7,8-pentahydroxyoct-2-enoate.
| Compound Name | methyl (E,4S,5R,6S,7R)-4,5,6,7,8-pentahydroxyoct-2-enoate |
|---|---|
| PubChem CID | 10977424 |
| Molecular Formula | C9H16O7 |
| Molecular Weight | 236.22 g/mol |
| Exact Mass | 236.09 |
| IUPAC Name | methyl (E,4S,5R,6S,7R)-4,5,6,7,8-pentahydroxyoct-2-enoate |
| SMILES | COC(=O)/C=C/[C@H](O)[C@@H](O)[C@@H](O)[C@H](O)CO |
| InChI | InChI=1S/C9H16O7/c1-16-7(13)3-2-5(11)8(14)9(15)6(12)4-10/h2-3,5-6,8-12,14-15H,4H2,1H3/b3-2+/t5-,6+,8+,9-/m0/s1 |
| InChIKey | GSNBCZYZEUPBGC-PJKCDPHYSA-N |
| XLogP | -2.85 |
| TPSA | 127.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.22 |
| LogP ≤ 5 | -2.85 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|