C21H24O7 — CID 11773643
benzhydryl (E,4S,5R,6S,7R)-4,5,6,7,8-pentahydroxyoct-2-enoate (PubChem CID 11773643) has the molecular formula C21H24O7 and a molecular weight of 388.42 g/mol. Its IUPAC name is benzhydryl (E,4S,5R,6S,7R)-4,5,6,7,8-pentahydroxyoct-2-enoate.
| Compound Name | benzhydryl (E,4S,5R,6S,7R)-4,5,6,7,8-pentahydroxyoct-2-enoate |
|---|---|
| PubChem CID | 11773643 |
| Molecular Formula | C21H24O7 |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | benzhydryl (E,4S,5R,6S,7R)-4,5,6,7,8-pentahydroxyoct-2-enoate |
| SMILES | O=C(/C=C/[C@H](O)[C@@H](O)[C@@H](O)[C@H](O)CO)OC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H24O7/c22-13-17(24)20(27)19(26)16(23)11-12-18(25)28-21(14-7-3-1-4-8-14)15-9-5-2-6-10-15/h1-12,16-17,19-24,26-27H,13H2/b12-11+/t16-,17+,19+,20-/m0/s1 |
| InChIKey | FYXHOWXCJBRYST-UAMJQJDGSA-N |
| XLogP | 0.31 |
| TPSA | 127.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|