C12H16O4 — CID 71511914
(E,2R,3R,4S)-6-phenylhex-5-ene-1,2,3,4-tetrol (PubChem CID 71511914) has the molecular formula C12H16O4 and a molecular weight of 224.26 g/mol. Its IUPAC name is (E,2R,3R,4S)-6-phenylhex-5-ene-1,2,3,4-tetrol.
| Compound Name | (E,2R,3R,4S)-6-phenylhex-5-ene-1,2,3,4-tetrol |
|---|---|
| PubChem CID | 71511914 |
| Molecular Formula | C12H16O4 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | (E,2R,3R,4S)-6-phenylhex-5-ene-1,2,3,4-tetrol |
| SMILES | OC[C@@H](O)[C@H](O)[C@@H](O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C12H16O4/c13-8-11(15)12(16)10(14)7-6-9-4-2-1-3-5-9/h1-7,10-16H,8H2/b7-6+/t10-,11+,12+/m0/s1 |
| InChIKey | QPMZOKUJAFMCFS-XIVIADRMSA-N |
| XLogP | -0.23 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |