C13H18O7 — CID 88742811
benzaldehyde;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal (PubChem CID 88742811) has the molecular formula C13H18O7 and a molecular weight of 286.28 g/mol. Its IUPAC name is benzaldehyde;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal.
| Compound Name | benzaldehyde;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal |
|---|---|
| PubChem CID | 88742811 |
| Molecular Formula | C13H18O7 |
| Molecular Weight | 286.28 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | benzaldehyde;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal |
| SMILES | O=C[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO.O=Cc1ccccc1 |
| InChI | InChI=1S/C7H6O.C6H12O6/c8-6-7-4-2-1-3-5-7;7-1-3(9)5(11)6(12)4(10)2-8/h1-6H;1,3-6,8-12H,2H2/t;3-,4+,5+,6+/m.0/s1 |
| InChIKey | ZBQMPOWWQYVKGZ-SSPAHAAFSA-N |
| XLogP | -1.88 |
| TPSA | 135.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.28 |
| LogP ≤ 5 | -1.88 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|