C14H20O6 — CID 157337689
(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal;styrene (PubChem CID 157337689) has the molecular formula C14H20O6 and a molecular weight of 284.31 g/mol. Its IUPAC name is (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal;styrene.
| Compound Name | (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal;styrene |
|---|---|
| PubChem CID | 157337689 |
| Molecular Formula | C14H20O6 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal;styrene |
| SMILES | C=Cc1ccccc1.O=C[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C8H8.C6H12O6/c1-2-8-6-4-3-5-7-8;7-1-3(9)5(11)6(12)4(10)2-8/h2-7H,1H2;1,3-6,8-12H,2H2/t;3-,4+,5+,6+/m.0/s1 |
| InChIKey | BGAKHKPHXAAUQD-SSPAHAAFSA-N |
| XLogP | -1.05 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|