C26H29NO4 — CID 20656192
(E)-5-(benzhydrylamino)-7-phenylhept-6-ene-1,2,3,4-tetrol (PubChem CID 20656192) has the molecular formula C26H29NO4 and a molecular weight of 419.52 g/mol. Its IUPAC name is (E)-5-(benzhydrylamino)-7-phenylhept-6-ene-1,2,3,4-tetrol.
| Compound Name | (E)-5-(benzhydrylamino)-7-phenylhept-6-ene-1,2,3,4-tetrol |
|---|---|
| PubChem CID | 20656192 |
| Molecular Formula | C26H29NO4 |
| Molecular Weight | 419.52 g/mol |
| Exact Mass | 419.21 |
| IUPAC Name | (E)-5-(benzhydrylamino)-7-phenylhept-6-ene-1,2,3,4-tetrol |
| SMILES | OCC(O)C(O)C(O)C(/C=C/c1ccccc1)NC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H29NO4/c28-18-23(29)26(31)25(30)22(17-16-19-10-4-1-5-11-19)27-24(20-12-6-2-7-13-20)21-14-8-3-9-15-21/h1-17,22-31H,18H2/b17-16+ |
| InChIKey | OHNJRCGBVCQXGW-WUKNDPDISA-N |
| XLogP | 2.52 |
| TPSA | 92.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.52 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |