C24H27NO2 — CID 10981294
(2S,3S)-3-(benzhydrylamino)-5-phenylpentane-1,2-diol (PubChem CID 10981294) has the molecular formula C24H27NO2 and a molecular weight of 361.49 g/mol. Its IUPAC name is (2S,3S)-3-(benzhydrylamino)-5-phenylpentane-1,2-diol.
| Compound Name | (2S,3S)-3-(benzhydrylamino)-5-phenylpentane-1,2-diol |
|---|---|
| PubChem CID | 10981294 |
| Molecular Formula | C24H27NO2 |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.20 |
| IUPAC Name | (2S,3S)-3-(benzhydrylamino)-5-phenylpentane-1,2-diol |
| SMILES | OC[C@@H](O)[C@H](CCc1ccccc1)NC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H27NO2/c26-18-23(27)22(17-16-19-10-4-1-5-11-19)25-24(20-12-6-2-7-13-20)21-14-8-3-9-15-21/h1-15,22-27H,16-18H2/t22-,23+/m0/s1 |
| InChIKey | RBHOACOVQJNCQX-XZOQPEGZSA-N |
| XLogP | 3.72 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |