C12H19NO3 — CID 70991072
(2S,3R)-3-(1-phenylethylamino)butane-1,2,4-triol (PubChem CID 70991072) has the molecular formula C12H19NO3 and a molecular weight of 225.29 g/mol. Its IUPAC name is (2S,3R)-3-(1-phenylethylamino)butane-1,2,4-triol.
| Compound Name | (2S,3R)-3-(1-phenylethylamino)butane-1,2,4-triol |
|---|---|
| PubChem CID | 70991072 |
| Molecular Formula | C12H19NO3 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.14 |
| IUPAC Name | (2S,3R)-3-(1-phenylethylamino)butane-1,2,4-triol |
| SMILES | CC(N[C@H](CO)[C@H](O)CO)c1ccccc1 |
| InChI | InChI=1S/C12H19NO3/c1-9(10-5-3-2-4-6-10)13-11(7-14)12(16)8-15/h2-6,9,11-16H,7-8H2,1H3/t9?,11-,12-/m1/s1 |
| InChIKey | LSUJBNIMKUSMPR-JZXPMDSESA-N |
| XLogP | 0.05 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |