C26H36N2 — CID 101057436
(4R,5R)-2,7-dimethyl-4-N,5-N-bis[(1S)-1-phenylethyl]octa-1,7-diene-4,5-diamine (PubChem CID 101057436) has the molecular formula C26H36N2 and a molecular weight of 376.59 g/mol. Its IUPAC name is (4R,5R)-2,7-dimethyl-4-N,5-N-bis[(1S)-1-phenylethyl]octa-1,7-diene-4,5-diamine.
| Compound Name | (4R,5R)-2,7-dimethyl-4-N,5-N-bis[(1S)-1-phenylethyl]octa-1,7-diene-4,5-diamine |
|---|---|
| PubChem CID | 101057436 |
| Molecular Formula | C26H36N2 |
| Molecular Weight | 376.59 g/mol |
| Exact Mass | 376.29 |
| IUPAC Name | (4R,5R)-2,7-dimethyl-4-N,5-N-bis[(1S)-1-phenylethyl]octa-1,7-diene-4,5-diamine |
| SMILES | C=C(C)C[C@@H](N[C@@H](C)c1ccccc1)[C@@H](CC(=C)C)N[C@@H](C)c1ccccc1 |
| InChI | InChI=1S/C26H36N2/c1-19(2)17-25(27-21(5)23-13-9-7-10-14-23)26(18-20(3)4)28-22(6)24-15-11-8-12-16-24/h7-16,21-22,25-28H,1,3,17-18H2,2,4-6H3/t21-,22-,25+,26+/m0/s1 |
| InChIKey | PQVQPKGPIJPGPU-CNXCYTMISA-N |
| XLogP | 6.36 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.59 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|