C15H23N — CID 134858185
(3R,4S)-4-methyl-N-[(1R)-1-phenylethyl]hex-5-en-3-amine (PubChem CID 134858185) has the molecular formula C15H23N and a molecular weight of 217.36 g/mol. Its IUPAC name is (3R,4S)-4-methyl-N-[(1R)-1-phenylethyl]hex-5-en-3-amine.
| Compound Name | (3R,4S)-4-methyl-N-[(1R)-1-phenylethyl]hex-5-en-3-amine |
|---|---|
| PubChem CID | 134858185 |
| Molecular Formula | C15H23N |
| Molecular Weight | 217.36 g/mol |
| Exact Mass | 217.18 |
| IUPAC Name | (3R,4S)-4-methyl-N-[(1R)-1-phenylethyl]hex-5-en-3-amine |
| SMILES | C=C[C@H](C)[C@@H](CC)N[C@H](C)c1ccccc1 |
| InChI | InChI=1S/C15H23N/c1-5-12(3)15(6-2)16-13(4)14-10-8-7-9-11-14/h5,7-13,15-16H,1,6H2,2-4H3/t12-,13+,15+/m0/s1 |
| InChIKey | ODZFZFCGDYEXKK-GZBFAFLISA-N |
| XLogP | 3.94 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.36 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|