C21H25NO2 — CID 11484132
[(3R,4R)-5-phenyl-4-[[(1R)-1-phenylethyl]amino]pent-1-en-3-yl] acetate (PubChem CID 11484132) has the molecular formula C21H25NO2 and a molecular weight of 323.44 g/mol. Its IUPAC name is [(3R,4R)-5-phenyl-4-[[(1R)-1-phenylethyl]amino]pent-1-en-3-yl] acetate.
| Compound Name | [(3R,4R)-5-phenyl-4-[[(1R)-1-phenylethyl]amino]pent-1-en-3-yl] acetate |
|---|---|
| PubChem CID | 11484132 |
| Molecular Formula | C21H25NO2 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.19 |
| IUPAC Name | [(3R,4R)-5-phenyl-4-[[(1R)-1-phenylethyl]amino]pent-1-en-3-yl] acetate |
| SMILES | C=C[C@@H](OC(C)=O)[C@@H](Cc1ccccc1)N[C@H](C)c1ccccc1 |
| InChI | InChI=1S/C21H25NO2/c1-4-21(24-17(3)23)20(15-18-11-7-5-8-12-18)22-16(2)19-13-9-6-10-14-19/h4-14,16,20-22H,1,15H2,2-3H3/t16-,20-,21-/m1/s1 |
| InChIKey | DHZOWPZVYASDHC-MAODMQOUSA-N |
| XLogP | 4.07 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|