C33H31NO3 — CID 101117246
[(3S,4S)-5-(4-methoxyphenyl)-4-[(9-phenylfluoren-9-yl)amino]pent-1-en-3-yl] acetate (PubChem CID 101117246) has the molecular formula C33H31NO3 and a molecular weight of 489.62 g/mol. Its IUPAC name is [(3S,4S)-5-(4-methoxyphenyl)-4-[(9-phenylfluoren-9-yl)amino]pent-1-en-3-yl] acetate.
| Compound Name | [(3S,4S)-5-(4-methoxyphenyl)-4-[(9-phenylfluoren-9-yl)amino]pent-1-en-3-yl] acetate |
|---|---|
| PubChem CID | 101117246 |
| Molecular Formula | C33H31NO3 |
| Molecular Weight | 489.62 g/mol |
| Exact Mass | 489.23 |
| IUPAC Name | [(3S,4S)-5-(4-methoxyphenyl)-4-[(9-phenylfluoren-9-yl)amino]pent-1-en-3-yl] acetate |
| SMILES | C=C[C@H](OC(C)=O)[C@H](Cc1ccc(OC)cc1)NC1(c2ccccc2)c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C33H31NO3/c1-4-32(37-23(2)35)31(22-24-18-20-26(36-3)21-19-24)34-33(25-12-6-5-7-13-25)29-16-10-8-14-27(29)28-15-9-11-17-30(28)33/h4-21,31-32,34H,1,22H2,2-3H3/t31-,32-/m0/s1 |
| InChIKey | SPRAWOSFRYWWEI-ACHIHNKUSA-N |
| XLogP | 6.29 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.62 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|