C31H29NO2 — CID 15540900
(3R,4R)-5-(4-methoxyphenyl)-4-[(9-phenylfluoren-9-yl)amino]pent-1-en-3-ol (PubChem CID 15540900) has the molecular formula C31H29NO2 and a molecular weight of 447.58 g/mol. Its IUPAC name is (3R,4R)-5-(4-methoxyphenyl)-4-[(9-phenylfluoren-9-yl)amino]pent-1-en-3-ol.
| Compound Name | (3R,4R)-5-(4-methoxyphenyl)-4-[(9-phenylfluoren-9-yl)amino]pent-1-en-3-ol |
|---|---|
| PubChem CID | 15540900 |
| Molecular Formula | C31H29NO2 |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.22 |
| IUPAC Name | (3R,4R)-5-(4-methoxyphenyl)-4-[(9-phenylfluoren-9-yl)amino]pent-1-en-3-ol |
| SMILES | C=C[C@@H](O)[C@@H](Cc1ccc(OC)cc1)NC1(c2ccccc2)c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C31H29NO2/c1-3-30(33)29(21-22-17-19-24(34-2)20-18-22)32-31(23-11-5-4-6-12-23)27-15-9-7-13-25(27)26-14-8-10-16-28(26)31/h3-20,29-30,32-33H,1,21H2,2H3/t29-,30-/m1/s1 |
| InChIKey | VJJCBWIJRVBIAD-LOYHVIPDSA-N |
| XLogP | 5.72 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|