C21H25FO3 — CID 134243279
(3S,4R)-4-[(4-fluorophenyl)methyl]-5-[(4-methoxyphenyl)methoxy]hex-1-en-3-ol (PubChem CID 134243279) has the molecular formula C21H25FO3 and a molecular weight of 344.43 g/mol. Its IUPAC name is (3S,4R)-4-[(4-fluorophenyl)methyl]-5-[(4-methoxyphenyl)methoxy]hex-1-en-3-ol.
| Compound Name | (3S,4R)-4-[(4-fluorophenyl)methyl]-5-[(4-methoxyphenyl)methoxy]hex-1-en-3-ol |
|---|---|
| PubChem CID | 134243279 |
| Molecular Formula | C21H25FO3 |
| Molecular Weight | 344.43 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | (3S,4R)-4-[(4-fluorophenyl)methyl]-5-[(4-methoxyphenyl)methoxy]hex-1-en-3-ol |
| SMILES | C=C[C@H](O)[C@@H](Cc1ccc(F)cc1)C(C)OCc1ccc(OC)cc1 |
| InChI | InChI=1S/C21H25FO3/c1-4-21(23)20(13-16-5-9-18(22)10-6-16)15(2)25-14-17-7-11-19(24-3)12-8-17/h4-12,15,20-21,23H,1,13-14H2,2-3H3/t15?,20-,21-/m0/s1 |
| InChIKey | BHXOQGTYZVJOSK-LBTAZEDMSA-N |
| XLogP | 4.15 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.43 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|