C24H40O5 — CID 118644132
1-[[(2S,3S)-3-[(1R)-1-(2,2-diethoxyethoxy)prop-2-enyl]heptan-2-yl]oxymethyl]-4-methoxybenzene (PubChem CID 118644132) has the molecular formula C24H40O5 and a molecular weight of 408.58 g/mol. Its IUPAC name is 1-[[(2S,3S)-3-[(1R)-1-(2,2-diethoxyethoxy)prop-2-enyl]heptan-2-yl]oxymethyl]-4-methoxybenzene.
| Compound Name | 1-[[(2S,3S)-3-[(1R)-1-(2,2-diethoxyethoxy)prop-2-enyl]heptan-2-yl]oxymethyl]-4-methoxybenzene |
|---|---|
| PubChem CID | 118644132 |
| Molecular Formula | C24H40O5 |
| Molecular Weight | 408.58 g/mol |
| Exact Mass | 408.29 |
| IUPAC Name | 1-[[(2S,3S)-3-[(1R)-1-(2,2-diethoxyethoxy)prop-2-enyl]heptan-2-yl]oxymethyl]-4-methoxybenzene |
| SMILES | C=C[C@@H](OCC(OCC)OCC)[C@@H](CCCC)[C@H](C)OCc1ccc(OC)cc1 |
| InChI | InChI=1S/C24H40O5/c1-7-11-12-22(23(8-2)29-18-24(26-9-3)27-10-4)19(5)28-17-20-13-15-21(25-6)16-14-20/h8,13-16,19,22-24H,2,7,9-12,17-18H2,1,3-6H3/t19-,22-,23+/m0/s1 |
| InChIKey | MCOWGGHEUYHAOB-AJSBUHFISA-N |
| XLogP | 5.38 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.58 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|