About butane;1-[(2S)-2-ethoxypropyl]-4-methoxybenzene;prop-1-ene
butane;1-[(2S)-2-ethoxypropyl]-4-methoxybenzene;prop-1-ene (PubChem CID 142022793) has the molecular formula C19H34O2
and a molecular weight of 294.48 g/mol. Its IUPAC name is butane;1-[(2S)-2-ethoxypropyl]-4-methoxybenzene;prop-1-ene.
Molecular Properties
| Compound Name | butane;1-[(2S)-2-ethoxypropyl]-4-methoxybenzene;prop-1-ene |
| PubChem CID | 142022793 |
| Molecular Formula | C19H34O2 |
| Molecular Weight | 294.48 g/mol |
| Exact Mass | 294.26 |
| IUPAC Name | butane;1-[(2S)-2-ethoxypropyl]-4-methoxybenzene;prop-1-ene |
| SMILES | C=CC.CCCC.CCO[C@@H](C)Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C12H18O2.C4H10.C3H6/c1-4-14-10(2)9-11-5-7-12(13-3)8-6-11;1-3-4-2;1-3-2/h5-8,10H,4,9H2,1-3H3;3-4H2,1-2H3;3H,1H2,2H3/t10-;;/m0../s1 |
| InChIKey | NKUCZTASRHOCDK-XRIOVQLTSA-N |
| XLogP | 5.66 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 294.48 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze butane;1-[(2S)-2-ethoxypropyl]-4-methoxybenzene;prop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane;1-[(2S)-2-ethoxypropyl]-4-methoxybenzene;prop-1-ene?
The IUPAC name of butane;1-[(2S)-2-ethoxypropyl]-4-methoxybenzene;prop-1-ene (CID 142022793) is butane;1-[(2S)-2-ethoxypropyl]-4-methoxybenzene;prop-1-ene.
What is the SMILES notation for butane;1-[(2S)-2-ethoxypropyl]-4-methoxybenzene;prop-1-ene?
The canonical SMILES for butane;1-[(2S)-2-ethoxypropyl]-4-methoxybenzene;prop-1-ene is C=CC.CCCC.CCO[C@@H](C)Cc1ccc(OC)cc1.
What is the InChIKey of butane;1-[(2S)-2-ethoxypropyl]-4-methoxybenzene;prop-1-ene?
The InChIKey is NKUCZTASRHOCDK-XRIOVQLTSA-N. The full InChI is InChI=1S/C12H18O2.C4H10.C3H6/c1-4-14-10(2)9-11-5-7-12(13-3)8-6-11;1-3-4-2;1-3-2/h5-8,10H,4,9H2,1-3H3;3-4H2,1-2H3;3H,1H2,2H3/t10-;;/m0../s1.
What are the key properties of butane;1-[(2S)-2-ethoxypropyl]-4-methoxybenzene;prop-1-ene?
butane;1-[(2S)-2-ethoxypropyl]-4-methoxybenzene;prop-1-ene has a molecular weight of 294.48 g/mol, XLogP of 5.66, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butane;1-[(2S)-2-ethoxypropyl]-4-methoxybenzene;prop-1-ene is sourced from PubChem (CID 142022793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).