C26H44O4Si — CID 71812303
[(3S)-hept-1-en-3-yl]oxy-[(3R)-5-[(4-methoxyphenyl)methoxy]pent-1-en-3-yl]oxy-di(propan-2-yl)silane (PubChem CID 71812303) has the molecular formula C26H44O4Si and a molecular weight of 448.72 g/mol. Its IUPAC name is [(3S)-hept-1-en-3-yl]oxy-[(3R)-5-[(4-methoxyphenyl)methoxy]pent-1-en-3-yl]oxy-di(propan-2-yl)silane.
| Compound Name | [(3S)-hept-1-en-3-yl]oxy-[(3R)-5-[(4-methoxyphenyl)methoxy]pent-1-en-3-yl]oxy-di(propan-2-yl)silane |
|---|---|
| PubChem CID | 71812303 |
| Molecular Formula | C26H44O4Si |
| Molecular Weight | 448.72 g/mol |
| Exact Mass | 448.30 |
| IUPAC Name | [(3S)-hept-1-en-3-yl]oxy-[(3R)-5-[(4-methoxyphenyl)methoxy]pent-1-en-3-yl]oxy-di(propan-2-yl)silane |
| SMILES | C=C[C@H](CCCC)O[Si](O[C@@H](C=C)CCOCc1ccc(OC)cc1)(C(C)C)C(C)C |
| InChI | InChI=1S/C26H44O4Si/c1-9-12-13-24(10-2)29-31(21(4)5,22(6)7)30-25(11-3)18-19-28-20-23-14-16-26(27-8)17-15-23/h10-11,14-17,21-22,24-25H,2-3,9,12-13,18-20H2,1,4-8H3/t24-,25+/m1/s1 |
| InChIKey | QSDRNHSOPQYVGY-RPBOFIJWSA-N |
| XLogP | 7.20 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.72 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|