C24H42O5Si — CID 71733102
tert-butyl-[(3S,4R,5S)-5-(methoxymethoxy)-7-[(4-methoxyphenyl)methoxy]-4-methylhept-1-en-3-yl]oxy-dimethylsilane (PubChem CID 71733102) has the molecular formula C24H42O5Si and a molecular weight of 438.68 g/mol. Its IUPAC name is tert-butyl-[(3S,4R,5S)-5-(methoxymethoxy)-7-[(4-methoxyphenyl)methoxy]-4-methylhept-1-en-3-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(3S,4R,5S)-5-(methoxymethoxy)-7-[(4-methoxyphenyl)methoxy]-4-methylhept-1-en-3-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 71733102 |
| Molecular Formula | C24H42O5Si |
| Molecular Weight | 438.68 g/mol |
| Exact Mass | 438.28 |
| IUPAC Name | tert-butyl-[(3S,4R,5S)-5-(methoxymethoxy)-7-[(4-methoxyphenyl)methoxy]-4-methylhept-1-en-3-yl]oxy-dimethylsilane |
| SMILES | C=C[C@H](O[Si](C)(C)C(C)(C)C)[C@H](C)[C@H](CCOCc1ccc(OC)cc1)OCOC |
| InChI | InChI=1S/C24H42O5Si/c1-10-22(29-30(8,9)24(3,4)5)19(2)23(28-18-25-6)15-16-27-17-20-11-13-21(26-7)14-12-20/h10-14,19,22-23H,1,15-18H2,2-9H3/t19-,22-,23-/m0/s1 |
| InChIKey | HNNRSKITYALRMR-VJBMBRPKSA-N |
| XLogP | 5.80 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.68 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|