C22H34O4Si — CID 11703821
(E)-5-[tert-butyl(dimethyl)silyl]oxy-7-[(4-methoxyphenyl)methoxy]-4-methylidenehept-2-enal (PubChem CID 11703821) has the molecular formula C22H34O4Si and a molecular weight of 390.60 g/mol. Its IUPAC name is (E)-5-[tert-butyl(dimethyl)silyl]oxy-7-[(4-methoxyphenyl)methoxy]-4-methylidenehept-2-enal.
| Compound Name | (E)-5-[tert-butyl(dimethyl)silyl]oxy-7-[(4-methoxyphenyl)methoxy]-4-methylidenehept-2-enal |
|---|---|
| PubChem CID | 11703821 |
| Molecular Formula | C22H34O4Si |
| Molecular Weight | 390.60 g/mol |
| Exact Mass | 390.22 |
| IUPAC Name | (E)-5-[tert-butyl(dimethyl)silyl]oxy-7-[(4-methoxyphenyl)methoxy]-4-methylidenehept-2-enal |
| SMILES | C=C(/C=C/C=O)C(CCOCc1ccc(OC)cc1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H34O4Si/c1-18(9-8-15-23)21(26-27(6,7)22(2,3)4)14-16-25-17-19-10-12-20(24-5)13-11-19/h8-13,15,21H,1,14,16-17H2,2-7H3/b9-8+ |
| InChIKey | BBSIJSUCEORFTD-CMDGGOBGSA-N |
| XLogP | 5.30 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.60 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|