C35H62O6Si2 — CID 11061225
(2E,4S,6S,7R,8R,9E)-4,6-bis[[tert-butyl(dimethyl)silyl]oxy]-8-methoxy-11-[(4-methoxyphenyl)methoxy]-3,7,9-trimethylundeca-2,9-dienal (PubChem CID 11061225) has the molecular formula C35H62O6Si2 and a molecular weight of 635.05 g/mol. Its IUPAC name is (2E,4S,6S,7R,8R,9E)-4,6-bis[[tert-butyl(dimethyl)silyl]oxy]-8-methoxy-11-[(4-methoxyphenyl)methoxy]-3,7,9-trimethylundeca-2,9-dienal.
| Compound Name | (2E,4S,6S,7R,8R,9E)-4,6-bis[[tert-butyl(dimethyl)silyl]oxy]-8-methoxy-11-[(4-methoxyphenyl)methoxy]-3,7,9-trimethylundeca-2,9-dienal |
|---|---|
| PubChem CID | 11061225 |
| Molecular Formula | C35H62O6Si2 |
| Molecular Weight | 635.05 g/mol |
| Exact Mass | 634.41 |
| IUPAC Name | (2E,4S,6S,7R,8R,9E)-4,6-bis[[tert-butyl(dimethyl)silyl]oxy]-8-methoxy-11-[(4-methoxyphenyl)methoxy]-3,7,9-trimethylundeca-2,9-dienal |
| SMILES | COc1ccc(COC/C=C(\C)[C@H](OC)[C@@H](C)[C@H](C[C@H](O[Si](C)(C)C(C)(C)C)/C(C)=C/C=O)O[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C35H62O6Si2/c1-26(20-22-36)31(40-42(12,13)34(4,5)6)24-32(41-43(14,15)35(7,8)9)28(3)33(38-11)27(2)21-23-39-25-29-16-18-30(37-10)19-17-29/h16-22,28,31-33H,23-25H2,1-15H3/b26-20+,27-21+/t28-,31-,32-,33-/m0/s1 |
| InChIKey | LPMGAKKSPREVDW-ILLCGRCLSA-N |
| XLogP | 9.13 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.05 |
| LogP ≤ 5 | 9.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|