C31H54O7Si — CID 102461439
(2E,4R,5R,6S,8S,9E)-11-[tert-butyl(dimethyl)silyl]oxy-4-methoxy-8-(methoxymethoxy)-1-[(4-methoxyphenyl)methoxy]-3,5,9-trimethylundeca-2,9-dien-6-ol (PubChem CID 102461439) has the molecular formula C31H54O7Si and a molecular weight of 566.85 g/mol. Its IUPAC name is (2E,4R,5R,6S,8S,9E)-11-[tert-butyl(dimethyl)silyl]oxy-4-methoxy-8-(methoxymethoxy)-1-[(4-methoxyphenyl)methoxy]-3,5,9-trimethylundeca-2,9-dien-6-ol.
| Compound Name | (2E,4R,5R,6S,8S,9E)-11-[tert-butyl(dimethyl)silyl]oxy-4-methoxy-8-(methoxymethoxy)-1-[(4-methoxyphenyl)methoxy]-3,5,9-trimethylundeca-2,9-dien-6-ol |
|---|---|
| PubChem CID | 102461439 |
| Molecular Formula | C31H54O7Si |
| Molecular Weight | 566.85 g/mol |
| Exact Mass | 566.36 |
| IUPAC Name | (2E,4R,5R,6S,8S,9E)-11-[tert-butyl(dimethyl)silyl]oxy-4-methoxy-8-(methoxymethoxy)-1-[(4-methoxyphenyl)methoxy]-3,5,9-trimethylundeca-2,9-dien-6-ol |
| SMILES | COCO[C@@H](C[C@H](O)[C@@H](C)[C@@H](OC)/C(C)=C/COCc1ccc(OC)cc1)/C(C)=C/CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C31H54O7Si/c1-23(17-19-38-39(10,11)31(4,5)6)29(37-22-33-7)20-28(32)25(3)30(35-9)24(2)16-18-36-21-26-12-14-27(34-8)15-13-26/h12-17,25,28-30,32H,18-22H2,1-11H3/b23-17+,24-16+/t25-,28+,29+,30+/m1/s1 |
| InChIKey | CPWWFTDTDILJHS-YLLCCIFDSA-N |
| XLogP | 6.52 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.85 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|