C19H30O5 — CID 10860702
(E,3S,4S,5R)-5-methoxy-8-[(4-methoxyphenyl)methoxy]-4,6-dimethyloct-6-ene-1,3-diol (PubChem CID 10860702) has the molecular formula C19H30O5 and a molecular weight of 338.44 g/mol. Its IUPAC name is (E,3S,4S,5R)-5-methoxy-8-[(4-methoxyphenyl)methoxy]-4,6-dimethyloct-6-ene-1,3-diol.
| Compound Name | (E,3S,4S,5R)-5-methoxy-8-[(4-methoxyphenyl)methoxy]-4,6-dimethyloct-6-ene-1,3-diol |
|---|---|
| PubChem CID | 10860702 |
| Molecular Formula | C19H30O5 |
| Molecular Weight | 338.44 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | (E,3S,4S,5R)-5-methoxy-8-[(4-methoxyphenyl)methoxy]-4,6-dimethyloct-6-ene-1,3-diol |
| SMILES | COc1ccc(COC/C=C(\C)[C@H](OC)[C@@H](C)[C@@H](O)CCO)cc1 |
| InChI | InChI=1S/C19H30O5/c1-14(19(23-4)15(2)18(21)9-11-20)10-12-24-13-16-5-7-17(22-3)8-6-16/h5-8,10,15,18-21H,9,11-13H2,1-4H3/b14-10+/t15-,18-,19-/m0/s1 |
| InChIKey | BRWUZPXFDLTJSW-OBJSAPPHSA-N |
| XLogP | 2.55 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.44 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|