C21H27NO3 — CID 145494424
(E)-3-(4-methoxyanilino)-4-methyl-6-phenylmethoxyhex-4-en-1-ol (PubChem CID 145494424) has the molecular formula C21H27NO3 and a molecular weight of 341.45 g/mol. Its IUPAC name is (E)-3-(4-methoxyanilino)-4-methyl-6-phenylmethoxyhex-4-en-1-ol.
| Compound Name | (E)-3-(4-methoxyanilino)-4-methyl-6-phenylmethoxyhex-4-en-1-ol |
|---|---|
| PubChem CID | 145494424 |
| Molecular Formula | C21H27NO3 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.20 |
| IUPAC Name | (E)-3-(4-methoxyanilino)-4-methyl-6-phenylmethoxyhex-4-en-1-ol |
| SMILES | COc1ccc(NC(CCO)/C(C)=C/COCc2ccccc2)cc1 |
| InChI | InChI=1S/C21H27NO3/c1-17(13-15-25-16-18-6-4-3-5-7-18)21(12-14-23)22-19-8-10-20(24-2)11-9-19/h3-11,13,21-23H,12,14-16H2,1-2H3/b17-13+ |
| InChIKey | LPHMNSGAZBGWMV-GHRIWEEISA-N |
| XLogP | 4.02 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|