C19H22N4O3 — CID 102385284
(3S,4S)-3-azido-4-(4-methoxyanilino)-5-phenylmethoxypentan-2-one (PubChem CID 102385284) has the molecular formula C19H22N4O3 and a molecular weight of 354.41 g/mol. Its IUPAC name is (3S,4S)-3-azido-4-(4-methoxyanilino)-5-phenylmethoxypentan-2-one.
| Compound Name | (3S,4S)-3-azido-4-(4-methoxyanilino)-5-phenylmethoxypentan-2-one |
|---|---|
| PubChem CID | 102385284 |
| Molecular Formula | C19H22N4O3 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | (3S,4S)-3-azido-4-(4-methoxyanilino)-5-phenylmethoxypentan-2-one |
| SMILES | COc1ccc(N[C@H](COCc2ccccc2)[C@H](N=[N+]=[N-])C(C)=O)cc1 |
| InChI | InChI=1S/C19H22N4O3/c1-14(24)19(22-23-20)18(13-26-12-15-6-4-3-5-7-15)21-16-8-10-17(25-2)11-9-16/h3-11,18-19,21H,12-13H2,1-2H3/t18-,19-/m1/s1 |
| InChIKey | NEMZMLKWQKQSOF-RTBURBONSA-N |
| XLogP | 3.96 |
| TPSA | 96.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|