C28H33NO7 — CID 11677658
methyl (2R,3R,4S,5R)-2,3-dihydroxy-5-(4-methoxyanilino)-4,6-bis(phenylmethoxy)hexanoate (PubChem CID 11677658) has the molecular formula C28H33NO7 and a molecular weight of 495.57 g/mol. Its IUPAC name is methyl (2R,3R,4S,5R)-2,3-dihydroxy-5-(4-methoxyanilino)-4,6-bis(phenylmethoxy)hexanoate.
| Compound Name | methyl (2R,3R,4S,5R)-2,3-dihydroxy-5-(4-methoxyanilino)-4,6-bis(phenylmethoxy)hexanoate |
|---|---|
| PubChem CID | 11677658 |
| Molecular Formula | C28H33NO7 |
| Molecular Weight | 495.57 g/mol |
| Exact Mass | 495.23 |
| IUPAC Name | methyl (2R,3R,4S,5R)-2,3-dihydroxy-5-(4-methoxyanilino)-4,6-bis(phenylmethoxy)hexanoate |
| SMILES | COC(=O)[C@H](O)[C@@H](O)[C@@H](OCc1ccccc1)[C@@H](COCc1ccccc1)Nc1ccc(OC)cc1 |
| InChI | InChI=1S/C28H33NO7/c1-33-23-15-13-22(14-16-23)29-24(19-35-17-20-9-5-3-6-10-20)27(25(30)26(31)28(32)34-2)36-18-21-11-7-4-8-12-21/h3-16,24-27,29-31H,17-19H2,1-2H3/t24-,25-,26-,27+/m1/s1 |
| InChIKey | NYEPEFNTRILNOO-CWTOASCOSA-N |
| XLogP | 3.17 |
| TPSA | 106.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.57 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|