C21H26O5 — CID 10737104
methyl (2R,3S,4S)-2-hydroxy-3,4-bis(phenylmethoxy)hexanoate (PubChem CID 10737104) has the molecular formula C21H26O5 and a molecular weight of 358.43 g/mol. Its IUPAC name is methyl (2R,3S,4S)-2-hydroxy-3,4-bis(phenylmethoxy)hexanoate.
| Compound Name | methyl (2R,3S,4S)-2-hydroxy-3,4-bis(phenylmethoxy)hexanoate |
|---|---|
| PubChem CID | 10737104 |
| Molecular Formula | C21H26O5 |
| Molecular Weight | 358.43 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | methyl (2R,3S,4S)-2-hydroxy-3,4-bis(phenylmethoxy)hexanoate |
| SMILES | CC[C@H](OCc1ccccc1)[C@@H](OCc1ccccc1)[C@@H](O)C(=O)OC |
| InChI | InChI=1S/C21H26O5/c1-3-18(25-14-16-10-6-4-7-11-16)20(19(22)21(23)24-2)26-15-17-12-8-5-9-13-17/h4-13,18-20,22H,3,14-15H2,1-2H3/t18-,19+,20+/m0/s1 |
| InChIKey | WLIAWYDWHANENB-XUVXKRRUSA-N |
| XLogP | 3.10 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.43 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |