C14H20O4 — CID 11791672
methyl (2R,3S,4R)-4-hydroxy-3-methyl-2-phenylmethoxypentanoate (PubChem CID 11791672) has the molecular formula C14H20O4 and a molecular weight of 252.31 g/mol. Its IUPAC name is methyl (2R,3S,4R)-4-hydroxy-3-methyl-2-phenylmethoxypentanoate.
| Compound Name | methyl (2R,3S,4R)-4-hydroxy-3-methyl-2-phenylmethoxypentanoate |
|---|---|
| PubChem CID | 11791672 |
| Molecular Formula | C14H20O4 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | methyl (2R,3S,4R)-4-hydroxy-3-methyl-2-phenylmethoxypentanoate |
| SMILES | COC(=O)[C@H](OCc1ccccc1)[C@@H](C)[C@@H](C)O |
| InChI | InChI=1S/C14H20O4/c1-10(11(2)15)13(14(16)17-3)18-9-12-7-5-4-6-8-12/h4-8,10-11,13,15H,9H2,1-3H3/t10-,11+,13+/m0/s1 |
| InChIKey | JQCSLOHHFPAZRI-DMDPSCGWSA-N |
| XLogP | 1.76 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |