C14H19NO5 — CID 11097976
methyl (2R)-3-methyl-2-(phenylmethoxycarbonylaminooxy)butanoate (PubChem CID 11097976) has the molecular formula C14H19NO5 and a molecular weight of 281.31 g/mol. Its IUPAC name is methyl (2R)-3-methyl-2-(phenylmethoxycarbonylaminooxy)butanoate.
| Compound Name | methyl (2R)-3-methyl-2-(phenylmethoxycarbonylaminooxy)butanoate |
|---|---|
| PubChem CID | 11097976 |
| Molecular Formula | C14H19NO5 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | methyl (2R)-3-methyl-2-(phenylmethoxycarbonylaminooxy)butanoate |
| SMILES | COC(=O)[C@H](ONC(=O)OCc1ccccc1)C(C)C |
| InChI | InChI=1S/C14H19NO5/c1-10(2)12(13(16)18-3)20-15-14(17)19-9-11-7-5-4-6-8-11/h4-8,10,12H,9H2,1-3H3,(H,15,17)/t12-/m1/s1 |
| InChIKey | NTLHBIQNZCPDOL-GFCCVEGCSA-N |
| XLogP | 2.04 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|