C17H26O3 — CID 101336587
2-[(E)-4-methyl-6-phenylmethoxyhex-4-enyl]propane-1,3-diol (PubChem CID 101336587) has the molecular formula C17H26O3 and a molecular weight of 278.39 g/mol. Its IUPAC name is 2-[(E)-4-methyl-6-phenylmethoxyhex-4-enyl]propane-1,3-diol.
| Compound Name | 2-[(E)-4-methyl-6-phenylmethoxyhex-4-enyl]propane-1,3-diol |
|---|---|
| PubChem CID | 101336587 |
| Molecular Formula | C17H26O3 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | 2-[(E)-4-methyl-6-phenylmethoxyhex-4-enyl]propane-1,3-diol |
| SMILES | C/C(=C\COCc1ccccc1)CCCC(CO)CO |
| InChI | InChI=1S/C17H26O3/c1-15(6-5-9-17(12-18)13-19)10-11-20-14-16-7-3-2-4-8-16/h2-4,7-8,10,17-19H,5-6,9,11-14H2,1H3/b15-10+ |
| InChIKey | VJRCRUMYNOICQL-XNTDXEJSSA-N |
| XLogP | 2.92 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|