C24H30O3 — CID 14609864
(6E)-6-methyl-8-phenylmethoxy-2-(phenylmethoxymethyl)octa-1,6-dien-3-ol (PubChem CID 14609864) has the molecular formula C24H30O3 and a molecular weight of 366.50 g/mol. Its IUPAC name is (6E)-6-methyl-8-phenylmethoxy-2-(phenylmethoxymethyl)octa-1,6-dien-3-ol.
| Compound Name | (6E)-6-methyl-8-phenylmethoxy-2-(phenylmethoxymethyl)octa-1,6-dien-3-ol |
|---|---|
| PubChem CID | 14609864 |
| Molecular Formula | C24H30O3 |
| Molecular Weight | 366.50 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | (6E)-6-methyl-8-phenylmethoxy-2-(phenylmethoxymethyl)octa-1,6-dien-3-ol |
| SMILES | C=C(COCc1ccccc1)C(O)CC/C(C)=C/COCc1ccccc1 |
| InChI | InChI=1S/C24H30O3/c1-20(15-16-26-18-22-9-5-3-6-10-22)13-14-24(25)21(2)17-27-19-23-11-7-4-8-12-23/h3-12,15,24-25H,2,13-14,16-19H2,1H3/b20-15+ |
| InChIKey | JDWVFFYDKCSENF-HMMYKYKNSA-N |
| XLogP | 5.06 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.50 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|