C27H40O2 — CID 11749906
(2E,6E,10E,14E)-1,1-dideuterio-2,6,10,14-tetramethyl-16-phenylmethoxyhexadeca-2,6,10,14-tetraen-1-ol (PubChem CID 11749906) has the molecular formula C27H40O2 and a molecular weight of 398.63 g/mol. Its IUPAC name is (2E,6E,10E,14E)-1,1-dideuterio-2,6,10,14-tetramethyl-16-phenylmethoxyhexadeca-2,6,10,14-tetraen-1-ol.
| Compound Name | (2E,6E,10E,14E)-1,1-dideuterio-2,6,10,14-tetramethyl-16-phenylmethoxyhexadeca-2,6,10,14-tetraen-1-ol |
|---|---|
| PubChem CID | 11749906 |
| Molecular Formula | C27H40O2 |
| Molecular Weight | 398.63 g/mol |
| Exact Mass | 398.32 |
| IUPAC Name | (2E,6E,10E,14E)-1,1-dideuterio-2,6,10,14-tetramethyl-16-phenylmethoxyhexadeca-2,6,10,14-tetraen-1-ol |
| SMILES | [2H]C([2H])(O)/C(C)=C/CC/C(C)=C/CC/C(C)=C/CC/C(C)=C/COCc1ccccc1 |
| InChI | InChI=1S/C27H40O2/c1-23(11-8-12-24(2)14-10-16-26(4)21-28)13-9-15-25(3)19-20-29-22-27-17-6-5-7-18-27/h5-7,12-13,16-19,28H,8-11,14-15,20-22H2,1-4H3/b23-13+,24-12+,25-19+,26-16+/i21D2 |
| InChIKey | GWCYQMYNXUHCMZ-SRPRPKITSA-N |
| XLogP | 7.32 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.63 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|