C17H23ClO — CID 14603983
[(2E)-6-chloro-3,7-dimethylocta-2,7-dienoxy]methylbenzene (PubChem CID 14603983) has the molecular formula C17H23ClO and a molecular weight of 278.82 g/mol. Its IUPAC name is [(2E)-6-chloro-3,7-dimethylocta-2,7-dienoxy]methylbenzene.
| Compound Name | [(2E)-6-chloro-3,7-dimethylocta-2,7-dienoxy]methylbenzene |
|---|---|
| PubChem CID | 14603983 |
| Molecular Formula | C17H23ClO |
| Molecular Weight | 278.82 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | [(2E)-6-chloro-3,7-dimethylocta-2,7-dienoxy]methylbenzene |
| SMILES | C=C(C)C(Cl)CC/C(C)=C/COCc1ccccc1 |
| InChI | InChI=1S/C17H23ClO/c1-14(2)17(18)10-9-15(3)11-12-19-13-16-7-5-4-6-8-16/h4-8,11,17H,1,9-10,12-13H2,2-3H3/b15-11+ |
| InChIKey | XDNXMTOLBLATEV-RVDMUPIBSA-N |
| XLogP | 5.11 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.82 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|