C21H30O — CID 23256565
[(3Z)-3-methyl-6-prop-1-en-2-yldeca-3,9-dienoxy]methylbenzene (PubChem CID 23256565) has the molecular formula C21H30O and a molecular weight of 298.47 g/mol. Its IUPAC name is [(3Z)-3-methyl-6-prop-1-en-2-yldeca-3,9-dienoxy]methylbenzene.
| Compound Name | [(3Z)-3-methyl-6-prop-1-en-2-yldeca-3,9-dienoxy]methylbenzene |
|---|---|
| PubChem CID | 23256565 |
| Molecular Formula | C21H30O |
| Molecular Weight | 298.47 g/mol |
| Exact Mass | 298.23 |
| IUPAC Name | [(3Z)-3-methyl-6-prop-1-en-2-yldeca-3,9-dienoxy]methylbenzene |
| SMILES | C=CCCC(C/C=C(/C)CCOCc1ccccc1)C(=C)C |
| InChI | InChI=1S/C21H30O/c1-5-6-12-21(18(2)3)14-13-19(4)15-16-22-17-20-10-8-7-9-11-20/h5,7-11,13,21H,1-2,6,12,14-17H2,3-4H3/b19-13- |
| InChIKey | ZZYNGMGWJHIFHR-UYRXBGFRSA-N |
| XLogP | 6.09 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.47 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|