C17H24O2 — CID 70556140
2,6-dimethyl-8-phenylmethoxyocta-1,6-dien-3-ol (PubChem CID 70556140) has the molecular formula C17H24O2 and a molecular weight of 260.38 g/mol. Its IUPAC name is 2,6-dimethyl-8-phenylmethoxyocta-1,6-dien-3-ol.
| Compound Name | 2,6-dimethyl-8-phenylmethoxyocta-1,6-dien-3-ol |
|---|---|
| PubChem CID | 70556140 |
| Molecular Formula | C17H24O2 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.18 |
| IUPAC Name | 2,6-dimethyl-8-phenylmethoxyocta-1,6-dien-3-ol |
| SMILES | C=C(C)C(O)CCC(C)=CCOCc1ccccc1 |
| InChI | InChI=1S/C17H24O2/c1-14(2)17(18)10-9-15(3)11-12-19-13-16-7-5-4-6-8-16/h4-8,11,17-18H,1,9-10,12-13H2,2-3H3 |
| InChIKey | FWZWUBXYCAZZBT-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|