C17H22O3 — CID 66896956
(2E,6E)-2,6-dimethyl-8-phenylmethoxyocta-2,6-dienoic acid (PubChem CID 66896956) has the molecular formula C17H22O3 and a molecular weight of 274.36 g/mol. Its IUPAC name is (2E,6E)-2,6-dimethyl-8-phenylmethoxyocta-2,6-dienoic acid.
| Compound Name | (2E,6E)-2,6-dimethyl-8-phenylmethoxyocta-2,6-dienoic acid |
|---|---|
| PubChem CID | 66896956 |
| Molecular Formula | C17H22O3 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | (2E,6E)-2,6-dimethyl-8-phenylmethoxyocta-2,6-dienoic acid |
| SMILES | C/C(=C\COCc1ccccc1)CC/C=C(\C)C(=O)O |
| InChI | InChI=1S/C17H22O3/c1-14(7-6-8-15(2)17(18)19)11-12-20-13-16-9-4-3-5-10-16/h3-5,8-11H,6-7,12-13H2,1-2H3,(H,18,19)/b14-11+,15-8+ |
| InChIKey | FXGFYPGNFJAXLF-GGQZXFEVSA-N |
| XLogP | 3.96 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|