C21H30O3 — CID 10404397
ethyl (E,6E)-2-methyl-6-(2-phenylmethoxyethylidene)non-2-enoate (PubChem CID 10404397) has the molecular formula C21H30O3 and a molecular weight of 330.47 g/mol. Its IUPAC name is ethyl (E,6E)-2-methyl-6-(2-phenylmethoxyethylidene)non-2-enoate.
| Compound Name | ethyl (E,6E)-2-methyl-6-(2-phenylmethoxyethylidene)non-2-enoate |
|---|---|
| PubChem CID | 10404397 |
| Molecular Formula | C21H30O3 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.22 |
| IUPAC Name | ethyl (E,6E)-2-methyl-6-(2-phenylmethoxyethylidene)non-2-enoate |
| SMILES | CCC/C(=C\COCc1ccccc1)CC/C=C(\C)C(=O)OCC |
| InChI | InChI=1S/C21H30O3/c1-4-10-19(14-9-11-18(3)21(22)24-5-2)15-16-23-17-20-12-7-6-8-13-20/h6-8,11-13,15H,4-5,9-10,14,16-17H2,1-3H3/b18-11+,19-15+ |
| InChIKey | HOIZYAGGUWEWEO-CFBAGHHKSA-N |
| XLogP | 5.22 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|