C28H46O7 — CID 57360752
ethyl (4S,5S,6R,7R,8S,9R,10R,11R,12R)-5,7,9,11-tetrahydroxy-2,4,6,8,10,12-hexamethyl-13-phenylmethoxytridec-2-enoate (PubChem CID 57360752) has the molecular formula C28H46O7 and a molecular weight of 494.67 g/mol. Its IUPAC name is ethyl (4S,5S,6R,7R,8S,9R,10R,11R,12R)-5,7,9,11-tetrahydroxy-2,4,6,8,10,12-hexamethyl-13-phenylmethoxytridec-2-enoate.
| Compound Name | ethyl (4S,5S,6R,7R,8S,9R,10R,11R,12R)-5,7,9,11-tetrahydroxy-2,4,6,8,10,12-hexamethyl-13-phenylmethoxytridec-2-enoate |
|---|---|
| PubChem CID | 57360752 |
| Molecular Formula | C28H46O7 |
| Molecular Weight | 494.67 g/mol |
| Exact Mass | 494.32 |
| IUPAC Name | ethyl (4S,5S,6R,7R,8S,9R,10R,11R,12R)-5,7,9,11-tetrahydroxy-2,4,6,8,10,12-hexamethyl-13-phenylmethoxytridec-2-enoate |
| SMILES | CCOC(=O)C(C)=C[C@H](C)[C@H](O)[C@@H](C)[C@@H](O)[C@H](C)[C@H](O)[C@H](C)[C@H](O)[C@H](C)COCc1ccccc1 |
| InChI | InChI=1S/C28H46O7/c1-8-35-28(33)18(3)14-17(2)24(29)20(5)26(31)22(7)27(32)21(6)25(30)19(4)15-34-16-23-12-10-9-11-13-23/h9-14,17,19-22,24-27,29-32H,8,15-16H2,1-7H3/t17-,19+,20+,21+,22-,24-,25+,26+,27+/m0/s1 |
| InChIKey | FIAOMBHYBNEREZ-RKEUVAMCSA-N |
| XLogP | 3.34 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.67 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|