C25H38O7 — CID 11797811
ethyl (E)-3-[(2S,3S)-3-[(2R,3S,4S,5S,6S,7S)-2,4,6-trihydroxy-3,5,7-trimethyl-8-phenylmethoxyoctyl]oxiran-2-yl]prop-2-enoate (PubChem CID 11797811) has the molecular formula C25H38O7 and a molecular weight of 450.57 g/mol. Its IUPAC name is ethyl (E)-3-[(2S,3S)-3-[(2R,3S,4S,5S,6S,7S)-2,4,6-trihydroxy-3,5,7-trimethyl-8-phenylmethoxyoctyl]oxiran-2-yl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[(2S,3S)-3-[(2R,3S,4S,5S,6S,7S)-2,4,6-trihydroxy-3,5,7-trimethyl-8-phenylmethoxyoctyl]oxiran-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 11797811 |
| Molecular Formula | C25H38O7 |
| Molecular Weight | 450.57 g/mol |
| Exact Mass | 450.26 |
| IUPAC Name | ethyl (E)-3-[(2S,3S)-3-[(2R,3S,4S,5S,6S,7S)-2,4,6-trihydroxy-3,5,7-trimethyl-8-phenylmethoxyoctyl]oxiran-2-yl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/[C@@H]1O[C@H]1C[C@@H](O)[C@H](C)[C@H](O)[C@@H](C)[C@@H](O)[C@@H](C)COCc1ccccc1 |
| InChI | InChI=1S/C25H38O7/c1-5-31-23(27)12-11-21-22(32-21)13-20(26)17(3)25(29)18(4)24(28)16(2)14-30-15-19-9-7-6-8-10-19/h6-12,16-18,20-22,24-26,28-29H,5,13-15H2,1-4H3/b12-11+/t16-,17-,18-,20+,21-,22-,24-,25-/m0/s1 |
| InChIKey | MBGLPSRCBAWINU-RANWGQKZSA-N |
| XLogP | 2.47 |
| TPSA | 108.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.57 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|