C35H62O6Si2 — CID 11104166
ethyl (E)-3-[(2S,3S)-3-[(2S,3S,4R,5S,6S)-4,6-dimethyl-7-phenylmethoxy-3,5-bis(triethylsilyloxy)heptan-2-yl]oxiran-2-yl]prop-2-enoate (PubChem CID 11104166) has the molecular formula C35H62O6Si2 and a molecular weight of 635.05 g/mol. Its IUPAC name is ethyl (E)-3-[(2S,3S)-3-[(2S,3S,4R,5S,6S)-4,6-dimethyl-7-phenylmethoxy-3,5-bis(triethylsilyloxy)heptan-2-yl]oxiran-2-yl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[(2S,3S)-3-[(2S,3S,4R,5S,6S)-4,6-dimethyl-7-phenylmethoxy-3,5-bis(triethylsilyloxy)heptan-2-yl]oxiran-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 11104166 |
| Molecular Formula | C35H62O6Si2 |
| Molecular Weight | 635.05 g/mol |
| Exact Mass | 634.41 |
| IUPAC Name | ethyl (E)-3-[(2S,3S)-3-[(2S,3S,4R,5S,6S)-4,6-dimethyl-7-phenylmethoxy-3,5-bis(triethylsilyloxy)heptan-2-yl]oxiran-2-yl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/[C@@H]1O[C@H]1[C@H](C)[C@H](O[Si](CC)(CC)CC)[C@H](C)[C@@H](O[Si](CC)(CC)CC)[C@@H](C)COCc1ccccc1 |
| InChI | InChI=1S/C35H62O6Si2/c1-11-38-32(36)24-23-31-35(39-31)29(10)34(41-43(15-5,16-6)17-7)28(9)33(40-42(12-2,13-3)14-4)27(8)25-37-26-30-21-19-18-20-22-30/h18-24,27-29,31,33-35H,11-17,25-26H2,1-10H3/b24-23+/t27-,28+,29+,31-,33-,34+,35-/m0/s1 |
| InChIKey | UFYGTALPLKNNGP-WAWUBBLGSA-N |
| XLogP | 8.78 |
| TPSA | 66.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.05 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|