C22H36O4Si — CID 71733589
methyl (E,4S,5R)-4-methyl-7-phenylmethoxy-5-triethylsilyloxyhept-2-enoate (PubChem CID 71733589) has the molecular formula C22H36O4Si and a molecular weight of 392.61 g/mol. Its IUPAC name is methyl (E,4S,5R)-4-methyl-7-phenylmethoxy-5-triethylsilyloxyhept-2-enoate.
| Compound Name | methyl (E,4S,5R)-4-methyl-7-phenylmethoxy-5-triethylsilyloxyhept-2-enoate |
|---|---|
| PubChem CID | 71733589 |
| Molecular Formula | C22H36O4Si |
| Molecular Weight | 392.61 g/mol |
| Exact Mass | 392.24 |
| IUPAC Name | methyl (E,4S,5R)-4-methyl-7-phenylmethoxy-5-triethylsilyloxyhept-2-enoate |
| SMILES | CC[Si](CC)(CC)O[C@H](CCOCc1ccccc1)[C@@H](C)/C=C/C(=O)OC |
| InChI | InChI=1S/C22H36O4Si/c1-6-27(7-2,8-3)26-21(19(4)14-15-22(23)24-5)16-17-25-18-20-12-10-9-11-13-20/h9-15,19,21H,6-8,16-18H2,1-5H3/b15-14+/t19-,21+/m0/s1 |
| InChIKey | FOSRHGYPJSIWGA-DMUFNVMESA-N |
| XLogP | 5.35 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.61 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|