C17H24O5 — CID 10913862
methyl (Z,4R,5R,7R)-7,8-dihydroxy-4-methyl-5-phenylmethoxyoct-2-enoate (PubChem CID 10913862) has the molecular formula C17H24O5 and a molecular weight of 308.37 g/mol. Its IUPAC name is methyl (Z,4R,5R,7R)-7,8-dihydroxy-4-methyl-5-phenylmethoxyoct-2-enoate.
| Compound Name | methyl (Z,4R,5R,7R)-7,8-dihydroxy-4-methyl-5-phenylmethoxyoct-2-enoate |
|---|---|
| PubChem CID | 10913862 |
| Molecular Formula | C17H24O5 |
| Molecular Weight | 308.37 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | methyl (Z,4R,5R,7R)-7,8-dihydroxy-4-methyl-5-phenylmethoxyoct-2-enoate |
| SMILES | COC(=O)/C=C\[C@@H](C)[C@@H](C[C@@H](O)CO)OCc1ccccc1 |
| InChI | InChI=1S/C17H24O5/c1-13(8-9-17(20)21-2)16(10-15(19)11-18)22-12-14-6-4-3-5-7-14/h3-9,13,15-16,18-19H,10-12H2,1-2H3/b9-8-/t13-,15-,16-/m1/s1 |
| InChIKey | HCCCJXJSQDHLAU-CNGXOOJCSA-N |
| XLogP | 1.68 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.37 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|