C14H18O3 — CID 134943373
methyl (E,4S,5R)-5-methoxy-4-methyl-5-phenylpent-2-enoate (PubChem CID 134943373) has the molecular formula C14H18O3 and a molecular weight of 234.29 g/mol. Its IUPAC name is methyl (E,4S,5R)-5-methoxy-4-methyl-5-phenylpent-2-enoate.
| Compound Name | methyl (E,4S,5R)-5-methoxy-4-methyl-5-phenylpent-2-enoate |
|---|---|
| PubChem CID | 134943373 |
| Molecular Formula | C14H18O3 |
| Molecular Weight | 234.29 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | methyl (E,4S,5R)-5-methoxy-4-methyl-5-phenylpent-2-enoate |
| SMILES | COC(=O)/C=C/[C@H](C)[C@@H](OC)c1ccccc1 |
| InChI | InChI=1S/C14H18O3/c1-11(9-10-13(15)16-2)14(17-3)12-7-5-4-6-8-12/h4-11,14H,1-3H3/b10-9+/t11-,14+/m0/s1 |
| InChIKey | FAXLNDXFUQGQOD-ULOCGOKBSA-N |
| XLogP | 2.74 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.29 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|