C13H16O2S — CID 11139120
methyl (Z,4S)-4-methyl-5-phenylsulfanylpent-2-enoate (PubChem CID 11139120) has the molecular formula C13H16O2S and a molecular weight of 236.34 g/mol. Its IUPAC name is methyl (Z,4S)-4-methyl-5-phenylsulfanylpent-2-enoate.
| Compound Name | methyl (Z,4S)-4-methyl-5-phenylsulfanylpent-2-enoate |
|---|---|
| PubChem CID | 11139120 |
| Molecular Formula | C13H16O2S |
| Molecular Weight | 236.34 g/mol |
| Exact Mass | 236.09 |
| IUPAC Name | methyl (Z,4S)-4-methyl-5-phenylsulfanylpent-2-enoate |
| SMILES | COC(=O)/C=C\[C@H](C)CSc1ccccc1 |
| InChI | InChI=1S/C13H16O2S/c1-11(8-9-13(14)15-2)10-16-12-6-4-3-5-7-12/h3-9,11H,10H2,1-2H3/b9-8-/t11-/m0/s1 |
| InChIKey | VCRKSRQSDOAIHG-IQQGHNRFSA-N |
| XLogP | 3.14 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.34 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|