C22H40O4Si — CID 10927398
(2S,3S,4S,5S)-2,4-dimethyl-7-phenylmethoxy-5-triethylsilyloxyheptane-1,3-diol (PubChem CID 10927398) has the molecular formula C22H40O4Si and a molecular weight of 396.64 g/mol. Its IUPAC name is (2S,3S,4S,5S)-2,4-dimethyl-7-phenylmethoxy-5-triethylsilyloxyheptane-1,3-diol.
| Compound Name | (2S,3S,4S,5S)-2,4-dimethyl-7-phenylmethoxy-5-triethylsilyloxyheptane-1,3-diol |
|---|---|
| PubChem CID | 10927398 |
| Molecular Formula | C22H40O4Si |
| Molecular Weight | 396.64 g/mol |
| Exact Mass | 396.27 |
| IUPAC Name | (2S,3S,4S,5S)-2,4-dimethyl-7-phenylmethoxy-5-triethylsilyloxyheptane-1,3-diol |
| SMILES | CC[Si](CC)(CC)O[C@@H](CCOCc1ccccc1)[C@@H](C)[C@@H](O)[C@@H](C)CO |
| InChI | InChI=1S/C22H40O4Si/c1-6-27(7-2,8-3)26-21(19(5)22(24)18(4)16-23)14-15-25-17-20-12-10-9-11-13-20/h9-13,18-19,21-24H,6-8,14-17H2,1-5H3/t18-,19+,21-,22-/m0/s1 |
| InChIKey | SUYJWRFUOKRPOP-MXNKGDRCSA-N |
| XLogP | 4.61 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.64 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|