C21H36O3Si — CID 11824661
(E,4S,5S)-4-methyl-7-phenylmethoxy-5-triethylsilyloxyhept-2-en-1-ol (PubChem CID 11824661) has the molecular formula C21H36O3Si and a molecular weight of 364.60 g/mol. Its IUPAC name is (E,4S,5S)-4-methyl-7-phenylmethoxy-5-triethylsilyloxyhept-2-en-1-ol.
| Compound Name | (E,4S,5S)-4-methyl-7-phenylmethoxy-5-triethylsilyloxyhept-2-en-1-ol |
|---|---|
| PubChem CID | 11824661 |
| Molecular Formula | C21H36O3Si |
| Molecular Weight | 364.60 g/mol |
| Exact Mass | 364.24 |
| IUPAC Name | (E,4S,5S)-4-methyl-7-phenylmethoxy-5-triethylsilyloxyhept-2-en-1-ol |
| SMILES | CC[Si](CC)(CC)O[C@@H](CCOCc1ccccc1)[C@@H](C)/C=C/CO |
| InChI | InChI=1S/C21H36O3Si/c1-5-25(6-2,7-3)24-21(19(4)12-11-16-22)15-17-23-18-20-13-9-8-10-14-20/h8-14,19,21-22H,5-7,15-18H2,1-4H3/b12-11+/t19-,21-/m0/s1 |
| InChIKey | OHTCWAPCDUKVNQ-ZKCNSREISA-N |
| XLogP | 5.17 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.60 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|