C34H58O5SSi2 — CID 11017650
[(3S,4R,5R,6R)-7-(benzenesulfonyl)-4,6-dimethyl-1-phenylmethoxy-5-triethylsilyloxyheptan-3-yl]oxy-triethylsilane (PubChem CID 11017650) has the molecular formula C34H58O5SSi2 and a molecular weight of 635.07 g/mol. Its IUPAC name is [(3S,4R,5R,6R)-7-(benzenesulfonyl)-4,6-dimethyl-1-phenylmethoxy-5-triethylsilyloxyheptan-3-yl]oxy-triethylsilane.
| Compound Name | [(3S,4R,5R,6R)-7-(benzenesulfonyl)-4,6-dimethyl-1-phenylmethoxy-5-triethylsilyloxyheptan-3-yl]oxy-triethylsilane |
|---|---|
| PubChem CID | 11017650 |
| Molecular Formula | C34H58O5SSi2 |
| Molecular Weight | 635.07 g/mol |
| Exact Mass | 634.35 |
| IUPAC Name | [(3S,4R,5R,6R)-7-(benzenesulfonyl)-4,6-dimethyl-1-phenylmethoxy-5-triethylsilyloxyheptan-3-yl]oxy-triethylsilane |
| SMILES | CC[Si](CC)(CC)O[C@H]([C@H](C)[C@H](CCOCc1ccccc1)O[Si](CC)(CC)CC)[C@@H](C)CS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C34H58O5SSi2/c1-9-41(10-2,11-3)38-33(25-26-37-27-31-21-17-15-18-22-31)30(8)34(39-42(12-4,13-5)14-6)29(7)28-40(35,36)32-23-19-16-20-24-32/h15-24,29-30,33-34H,9-14,25-28H2,1-8H3/t29-,30+,33-,34-/m0/s1 |
| InChIKey | AUZBUWRBNOTRQR-DDOVKQMLSA-N |
| XLogP | 9.12 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.07 |
| LogP ≤ 5 | 9.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|