C22H38O3Si — CID 11337930
benzyl (2S,3R)-2-methyl-3-triethylsilyloxyoctanoate (PubChem CID 11337930) has the molecular formula C22H38O3Si and a molecular weight of 378.63 g/mol. Its IUPAC name is benzyl (2S,3R)-2-methyl-3-triethylsilyloxyoctanoate.
| Compound Name | benzyl (2S,3R)-2-methyl-3-triethylsilyloxyoctanoate |
|---|---|
| PubChem CID | 11337930 |
| Molecular Formula | C22H38O3Si |
| Molecular Weight | 378.63 g/mol |
| Exact Mass | 378.26 |
| IUPAC Name | benzyl (2S,3R)-2-methyl-3-triethylsilyloxyoctanoate |
| SMILES | CCCCC[C@@H](O[Si](CC)(CC)CC)[C@H](C)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C22H38O3Si/c1-6-10-12-17-21(25-26(7-2,8-3)9-4)19(5)22(23)24-18-20-15-13-11-14-16-20/h11,13-16,19,21H,6-10,12,17-18H2,1-5H3/t19-,21+/m0/s1 |
| InChIKey | IRWRLYKXDPEDBM-PZJWPPBQSA-N |
| XLogP | 6.34 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.63 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|